C31H50N4O13S2 — CID 59025285
N-[2-[[2-[5-(dithiolan-3-yl)pentanoylamino]acetyl]amino]ethyl]-4-[[2,3,5,6-tetrahydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]amino]benzamide (PubChem CID 59025285) has the molecular formula C31H50N4O13S2 and a molecular weight of 750.89 g/mol. Its IUPAC name is N-[2-[[2-[5-(dithiolan-3-yl)pentanoylamino]acetyl]amino]ethyl]-4-[[2,3,5,6-tetrahydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]amino]benzamide.
| Compound Name | N-[2-[[2-[5-(dithiolan-3-yl)pentanoylamino]acetyl]amino]ethyl]-4-[[2,3,5,6-tetrahydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]amino]benzamide |
|---|---|
| PubChem CID | 59025285 |
| Molecular Formula | C31H50N4O13S2 |
| Molecular Weight | 750.89 g/mol |
| Exact Mass | 750.28 |
| IUPAC Name | N-[2-[[2-[5-(dithiolan-3-yl)pentanoylamino]acetyl]amino]ethyl]-4-[[2,3,5,6-tetrahydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]amino]benzamide |
| SMILES | O=C(CCCCC1CCSS1)NCC(=O)NCCNC(=O)c1ccc(NCC(O)C(O)C(OC2OC(CO)C(O)C(O)C2O)C(O)CO)cc1 |
| InChI | InChI=1S/C31H50N4O13S2/c36-15-21(39)29(48-31-28(45)27(44)26(43)22(16-37)47-31)25(42)20(38)13-34-18-7-5-17(6-8-18)30(46)33-11-10-32-24(41)14-35-23(40)4-2-1-3-19-9-12-49-50-19/h5-8,19-22,25-29,31,34,36-39,42-45H,1-4,9-16H2,(H,32,41)(H,33,46)(H,35,40) |
| InChIKey | MPKKZIRGYHRUFI-UHFFFAOYSA-N |
| XLogP | -2.97 |
| TPSA | 279.63 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.89 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|