About N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide
N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide (PubChem CID 59025331) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide |
| PubChem CID | 59025331 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide |
| SMILES | CCC(C)C1OC(C)C(C)C1NC(C)=O |
| InChI | InChI=1S/C12H23NO2/c1-6-7(2)12-11(13-10(5)14)8(3)9(4)15-12/h7-9,11-12H,6H2,1-5H3,(H,13,14) |
| InChIKey | ALUHJZVVOGANQE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide?
The IUPAC name of N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide (CID 59025331) is N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide.
What is the SMILES notation for N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide?
The canonical SMILES for N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide is CCC(C)C1OC(C)C(C)C1NC(C)=O.
What is the InChIKey of N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide?
The InChIKey is ALUHJZVVOGANQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-6-7(2)12-11(13-10(5)14)8(3)9(4)15-12/h7-9,11-12H,6H2,1-5H3,(H,13,14).
What are the key properties of N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide?
N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide has a molecular weight of 213.32 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide is sourced from PubChem (CID 59025331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).