About 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol
1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol (PubChem CID 59025337) has the molecular formula C8H15N3O3
and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol.
Molecular Properties
| Compound Name | 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol |
| PubChem CID | 59025337 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol |
| SMILES | CC1OC(C(O)CO)C(N=[N+]=[N-])C1C |
| InChI | InChI=1S/C8H15N3O3/c1-4-5(2)14-8(6(13)3-12)7(4)10-11-9/h4-8,12-13H,3H2,1-2H3 |
| InChIKey | CXAFBMQGWKXXKA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol?
The IUPAC name of 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol (CID 59025337) is 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol.
What is the SMILES notation for 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol?
The canonical SMILES for 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol is CC1OC(C(O)CO)C(N=[N+]=[N-])C1C.
What is the InChIKey of 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol?
The InChIKey is CXAFBMQGWKXXKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O3/c1-4-5(2)14-8(6(13)3-12)7(4)10-11-9/h4-8,12-13H,3H2,1-2H3.
What are the key properties of 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol?
1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol has a molecular weight of 201.23 g/mol, XLogP of 0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-azido-4,5-dimethyloxolan-2-yl)ethane-1,2-diol is sourced from PubChem (CID 59025337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).