C24H41NaO9 — CID 59025344
sodium (3R,4R)-4-hydroxy-6-[(3R,4R)-6-hydroxy-2,4,5-trimethyloxan-3-yl]oxy-5-methyl-3-[(4S)-3,4,5,6-tetramethyloxan-2-yl]oxyoxane-2-carboxylate (PubChem CID 59025344) has the molecular formula C24H41NaO9 and a molecular weight of 496.57 g/mol. Its IUPAC name is sodium (3R,4R)-4-hydroxy-6-[(3R,4R)-6-hydroxy-2,4,5-trimethyloxan-3-yl]oxy-5-methyl-3-[(4S)-3,4,5,6-tetramethyloxan-2-yl]oxyoxane-2-carboxylate.
| Compound Name | sodium (3R,4R)-4-hydroxy-6-[(3R,4R)-6-hydroxy-2,4,5-trimethyloxan-3-yl]oxy-5-methyl-3-[(4S)-3,4,5,6-tetramethyloxan-2-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 59025344 |
| Molecular Formula | C24H41NaO9 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | sodium (3R,4R)-4-hydroxy-6-[(3R,4R)-6-hydroxy-2,4,5-trimethyloxan-3-yl]oxy-5-methyl-3-[(4S)-3,4,5,6-tetramethyloxan-2-yl]oxyoxane-2-carboxylate |
| SMILES | CC1OC(O[C@H]2C(C(=O)[O-])OC(O[C@H]3C(C)OC(O)C(C)[C@H]3C)C(C)[C@H]2O)C(C)[C@@H](C)C1C.[Na+] |
| InChI | InChI=1S/C24H42O9.Na/c1-9-10(2)15(7)30-23(13(9)5)32-19-17(25)14(6)24(33-20(19)21(26)27)31-18-11(3)12(4)22(28)29-16(18)8;/h9-20,22-25,28H,1-8H3,(H,26,27);/q;+1/p-1/t9-,10?,11+,12?,13?,14?,15?,16?,17+,18+,19+,20?,22?,23?,24?;/m0./s1 |
| InChIKey | GVCGIJVQSXSFQA-DYNUBABUSA-M |
| XLogP | -2.11 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |