About 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium
4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium (PubChem CID 59025414) has the molecular formula C20H36N2Y-2
and a molecular weight of 393.43 g/mol. Its IUPAC name is 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium.
Molecular Properties
| Compound Name | 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium |
| PubChem CID | 59025414 |
| Molecular Formula | C20H36N2Y-2 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium |
| SMILES | [CH2-]C1CCCCC1[CH-]C1CC(C)N(C2CCNC2)C(C)C1C.[Y] |
| InChI | InChI=1S/C20H36N2.Y/c1-14-7-5-6-8-18(14)12-19-11-15(2)22(17(4)16(19)3)20-9-10-21-13-20;/h12,14-21H,1,5-11,13H2,2-4H3;/q-2; |
| InChIKey | LGWVQPGNRGLUIB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium?
The IUPAC name of 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium (CID 59025414) is 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium.
What is the SMILES notation for 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium?
The canonical SMILES for 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium is [CH2-]C1CCCCC1[CH-]C1CC(C)N(C2CCNC2)C(C)C1C.[Y].
What is the InChIKey of 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium?
The InChIKey is LGWVQPGNRGLUIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36N2.Y/c1-14-7-5-6-8-18(14)12-19-11-15(2)22(17(4)16(19)3)20-9-10-21-13-20;/h12,14-21H,1,5-11,13H2,2-4H3;/q-2;.
What are the key properties of 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium?
4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium has a molecular weight of 393.43 g/mol, XLogP of 3.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methanidylcyclohexyl)methyl]-2,3,6-trimethyl-1-pyrrolidin-3-ylpiperidine;yttrium is sourced from PubChem (CID 59025414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).