About 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid
2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid (PubChem CID 59025436) has the molecular formula C18H32N2O4
and a molecular weight of 340.46 g/mol. Its IUPAC name is 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid |
| PubChem CID | 59025436 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(N[C@H]2CCCC[C@@H]2CC(=O)O)CC1 |
| InChI | InChI=1S/C18H32N2O4/c1-18(2,3)24-17(23)20-10-8-14(9-11-20)19-15-7-5-4-6-13(15)12-16(21)22/h13-15,19H,4-12H2,1-3H3,(H,21,22)/t13-,15+/m1/s1 |
| InChIKey | ILUAYEBDTFMMMJ-HIFRSBDPSA-N |
| XLogP | 3.01 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid?
The IUPAC name of 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid (CID 59025436) is 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid.
What is the SMILES notation for 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid?
The canonical SMILES for 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid is CC(C)(C)OC(=O)N1CCC(N[C@H]2CCCC[C@@H]2CC(=O)O)CC1.
What is the InChIKey of 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid?
The InChIKey is ILUAYEBDTFMMMJ-HIFRSBDPSA-N. The full InChI is InChI=1S/C18H32N2O4/c1-18(2,3)24-17(23)20-10-8-14(9-11-20)19-15-7-5-4-6-13(15)12-16(21)22/h13-15,19H,4-12H2,1-3H3,(H,21,22)/t13-,15+/m1/s1.
What are the key properties of 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid?
2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid has a molecular weight of 340.46 g/mol, XLogP of 3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2S)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]cyclohexyl]acetic acid is sourced from PubChem (CID 59025436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).