About 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile
2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile (PubChem CID 59025453) has the molecular formula C14H25N3
and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile |
| PubChem CID | 59025453 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile |
| SMILES | CN1CCC(N[C@H]2CCCC[C@@H]2CC#N)CC1 |
| InChI | InChI=1S/C14H25N3/c1-17-10-7-13(8-11-17)16-14-5-3-2-4-12(14)6-9-15/h12-14,16H,2-8,10-11H2,1H3/t12-,14+/m1/s1 |
| InChIKey | XIYHRORWMLSTDL-OCCSQVGLSA-N |
| XLogP | 2.14 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile?
The IUPAC name of 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile (CID 59025453) is 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile.
What is the SMILES notation for 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile?
The canonical SMILES for 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile is CN1CCC(N[C@H]2CCCC[C@@H]2CC#N)CC1.
What is the InChIKey of 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile?
The InChIKey is XIYHRORWMLSTDL-OCCSQVGLSA-N. The full InChI is InChI=1S/C14H25N3/c1-17-10-7-13(8-11-17)16-14-5-3-2-4-12(14)6-9-15/h12-14,16H,2-8,10-11H2,1H3/t12-,14+/m1/s1.
What are the key properties of 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile?
2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile has a molecular weight of 235.37 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2S)-2-[(1-methylpiperidin-4-yl)amino]cyclohexyl]acetonitrile is sourced from PubChem (CID 59025453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).