C24H17ClN6O2S — CID 59025699
2-(4-chlorophenyl)-3-(4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one (PubChem CID 59025699) has the molecular formula C24H17ClN6O2S and a molecular weight of 488.96 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one.
| Compound Name | 2-(4-chlorophenyl)-3-(4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
|---|---|
| PubChem CID | 59025699 |
| Molecular Formula | C24H17ClN6O2S |
| Molecular Weight | 488.96 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
| SMILES | Cc1nc(-c2cnccn2)sc1C(=O)N1CCN2C(=O)c3ccncc3C21c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17ClN6O2S/c1-14-20(34-21(29-14)19-13-27-8-9-28-19)23(33)31-11-10-30-22(32)17-6-7-26-12-18(17)24(30,31)15-2-4-16(25)5-3-15/h2-9,12-13H,10-11H2,1H3 |
| InChIKey | YDPPIMYWFDOFEF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 92.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.96 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |