About 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one
9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one (PubChem CID 59025799) has the molecular formula C20H17ClN2O2
and a molecular weight of 352.82 g/mol. Its IUPAC name is 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one.
Molecular Properties
| Compound Name | 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one |
| PubChem CID | 59025799 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one |
| SMILES | O=C1c2ccccc2C2(c3ccc(Cl)cc3)N1CCN2C(=O)C1CC1 |
| InChI | InChI=1S/C20H17ClN2O2/c21-15-9-7-14(8-10-15)20-17-4-2-1-3-16(17)19(25)23(20)12-11-22(20)18(24)13-5-6-13/h1-4,7-10,13H,5-6,11-12H2 |
| InChIKey | DILKNXNQZMMRFL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one?
The IUPAC name of 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one (CID 59025799) is 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one.
What is the SMILES notation for 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one?
The canonical SMILES for 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one is O=C1c2ccccc2C2(c3ccc(Cl)cc3)N1CCN2C(=O)C1CC1.
What is the InChIKey of 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one?
The InChIKey is DILKNXNQZMMRFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN2O2/c21-15-9-7-14(8-10-15)20-17-4-2-1-3-16(17)19(25)23(20)12-11-22(20)18(24)13-5-6-13/h1-4,7-10,13H,5-6,11-12H2.
What are the key properties of 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one?
9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one has a molecular weight of 352.82 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9b-(4-chlorophenyl)-1-(cyclopropanecarbonyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one is sourced from PubChem (CID 59025799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).