C26H19ClN4O2S — CID 59025818
2-(4-chlorophenyl)-3-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one (PubChem CID 59025818) has the molecular formula C26H19ClN4O2S and a molecular weight of 486.98 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one.
| Compound Name | 2-(4-chlorophenyl)-3-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
|---|---|
| PubChem CID | 59025818 |
| Molecular Formula | C26H19ClN4O2S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)N1CCN2C(=O)c3ccncc3C21c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H19ClN4O2S/c1-16-22(34-23(29-16)17-5-3-2-4-6-17)25(33)31-14-13-30-24(32)20-11-12-28-15-21(20)26(30,31)18-7-9-19(27)10-8-18/h2-12,15H,13-14H2,1H3 |
| InChIKey | FFYWDXCJYNFJFM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |