About 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile
3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile (PubChem CID 59025906) has the molecular formula C19H14ClN3O2
and a molecular weight of 351.79 g/mol. Its IUPAC name is 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile.
Molecular Properties
| Compound Name | 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile |
| PubChem CID | 59025906 |
| Molecular Formula | C19H14ClN3O2 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile |
| SMILES | N#CCC(=O)N1CCN2C(=O)c3ccccc3C12c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14ClN3O2/c20-14-7-5-13(6-8-14)19-16-4-2-1-3-15(16)18(25)23(19)12-11-22(19)17(24)9-10-21/h1-8H,9,11-12H2 |
| InChIKey | QMGBMADCAWFFMP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile?
The IUPAC name of 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile (CID 59025906) is 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile.
What is the SMILES notation for 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile?
The canonical SMILES for 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile is N#CCC(=O)N1CCN2C(=O)c3ccccc3C12c1ccc(Cl)cc1.
What is the InChIKey of 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile?
The InChIKey is QMGBMADCAWFFMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClN3O2/c20-14-7-5-13(6-8-14)19-16-4-2-1-3-15(16)18(25)23(19)12-11-22(19)17(24)9-10-21/h1-8H,9,11-12H2.
What are the key properties of 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile?
3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile has a molecular weight of 351.79 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[9b-(4-chlorophenyl)-5-oxo-2,3-dihydroimidazo[2,1-a]isoindol-1-yl]-3-oxopropanenitrile is sourced from PubChem (CID 59025906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).