C19H13ClN4O2S — CID 59025907
2-(4-chlorophenyl)-3-(1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one (PubChem CID 59025907) has the molecular formula C19H13ClN4O2S and a molecular weight of 396.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one.
| Compound Name | 2-(4-chlorophenyl)-3-(1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
|---|---|
| PubChem CID | 59025907 |
| Molecular Formula | C19H13ClN4O2S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
| SMILES | O=C(c1cscn1)N1CCN2C(=O)c3ccncc3C12c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H13ClN4O2S/c20-13-3-1-12(2-4-13)19-15-9-21-6-5-14(15)17(25)23(19)7-8-24(19)18(26)16-10-27-11-22-16/h1-6,9-11H,7-8H2 |
| InChIKey | ZDHFTZLLCVOALC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |