C21H14ClFN4O3 — CID 59026046
2-(4-chlorophenyl)-3-(6-fluoropyridine-3-carbonyl)-11-oxido-3,6-diaza-11-azoniatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one (PubChem CID 59026046) has the molecular formula C21H14ClFN4O3 and a molecular weight of 424.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(6-fluoropyridine-3-carbonyl)-11-oxido-3,6-diaza-11-azoniatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one.
| Compound Name | 2-(4-chlorophenyl)-3-(6-fluoropyridine-3-carbonyl)-11-oxido-3,6-diaza-11-azoniatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
|---|---|
| PubChem CID | 59026046 |
| Molecular Formula | C21H14ClFN4O3 |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(6-fluoropyridine-3-carbonyl)-11-oxido-3,6-diaza-11-azoniatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
| SMILES | O=C(c1ccc(F)nc1)N1CCN2C(=O)c3cc[n+]([O-])cc3C12c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14ClFN4O3/c22-15-4-2-14(3-5-15)21-17-12-25(30)8-7-16(17)20(29)27(21)10-9-26(21)19(28)13-1-6-18(23)24-11-13/h1-8,11-12H,9-10H2 |
| InChIKey | NMQXEPABPCQYRK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|