C24H26ClFN6O4 — CID 59026094
7-chloro-6-[[[(3R,4R)-1-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-4-hydroxypyrrolidin-3-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 59026094) has the molecular formula C24H26ClFN6O4 and a molecular weight of 516.96 g/mol. Its IUPAC name is 7-chloro-6-[[[(3R,4R)-1-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-4-hydroxypyrrolidin-3-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 7-chloro-6-[[[(3R,4R)-1-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-4-hydroxypyrrolidin-3-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 59026094 |
| Molecular Formula | C24H26ClFN6O4 |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 7-chloro-6-[[[(3R,4R)-1-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-4-hydroxypyrrolidin-3-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | COc1ccc2ncc(F)c(CCN3C[C@@H](CNCc4nc5c(cc4Cl)OCC(=O)N5)[C@@H](O)C3)c2n1 |
| InChI | InChI=1S/C24H26ClFN6O4/c1-35-22-3-2-17-23(31-22)14(16(26)8-28-17)4-5-32-10-13(19(33)11-32)7-27-9-18-15(25)6-20-24(29-18)30-21(34)12-36-20/h2-3,6,8,13,19,27,33H,4-5,7,9-12H2,1H3,(H,29,30,34)/t13-,19+/m1/s1 |
| InChIKey | GOHOWUAAORPINE-YJYMSZOUSA-N |
| XLogP | 1.78 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |