C31H34N2O5S — CID 59026509
(E)-1-[(1S,5R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-en-1-one (PubChem CID 59026509) has the molecular formula C31H34N2O5S and a molecular weight of 546.69 g/mol. Its IUPAC name is (E)-1-[(1S,5R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[(1S,5R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59026509 |
| Molecular Formula | C31H34N2O5S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | (E)-1-[(1S,5R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-en-1-one |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1cccc(/C=C/C(=O)N2[C@@H]3CC4CC[C@]3(CS2(=O)=O)C4(C)C)c1 |
| InChI | InChI=1S/C31H34N2O5S/c1-21-26(32-29(38-21)23-9-5-4-6-10-23)15-17-37-25-11-7-8-22(18-25)12-13-28(34)33-27-19-24-14-16-31(27,30(24,2)3)20-39(33,35)36/h4-13,18,24,27H,14-17,19-20H2,1-3H3/b13-12+/t24?,27-,31-/m1/s1 |
| InChIKey | LDAOCTUAZZGLFK-PYYVYLTJSA-N |
| XLogP | 5.65 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|