About 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate
3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate (PubChem CID 59026582) has the molecular formula C22H22N2O5
and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate |
| PubChem CID | 59026582 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate |
| SMILES | [C-]#[N+]COc1cccc(CC2CN(C(=O)Oc3ccccc3)C[C@@H]2C(=O)OC)c1 |
| InChI | InChI=1S/C22H22N2O5/c1-23-15-28-19-10-6-7-16(12-19)11-17-13-24(14-20(17)21(25)27-2)22(26)29-18-8-4-3-5-9-18/h3-10,12,17,20H,11,13-15H2,2H3/t17?,20-/m0/s1 |
| InChIKey | CLSYCUBINRWYCJ-OZBJMMHXSA-N |
| XLogP | 3.40 |
| TPSA | 69.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate?
The IUPAC name of 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate (CID 59026582) is 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate.
What is the SMILES notation for 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate?
The canonical SMILES for 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate is [C-]#[N+]COc1cccc(CC2CN(C(=O)Oc3ccccc3)C[C@@H]2C(=O)OC)c1.
What is the InChIKey of 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate?
The InChIKey is CLSYCUBINRWYCJ-OZBJMMHXSA-N. The full InChI is InChI=1S/C22H22N2O5/c1-23-15-28-19-10-6-7-16(12-19)11-17-13-24(14-20(17)21(25)27-2)22(26)29-18-8-4-3-5-9-18/h3-10,12,17,20H,11,13-15H2,2H3/t17?,20-/m0/s1.
What are the key properties of 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate?
3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate has a molecular weight of 394.43 g/mol, XLogP of 3.40, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-methyl 1-O-phenyl (3R)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate is sourced from PubChem (CID 59026582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).