C14H23BrO — CID 59026899
(2R,6R)-6-bromo-2-[(2S)-2,6-dimethylhept-5-enyl]-3,6-dihydro-2H-pyran (PubChem CID 59026899) has the molecular formula C14H23BrO and a molecular weight of 287.24 g/mol. Its IUPAC name is (2R,6R)-6-bromo-2-[(2S)-2,6-dimethylhept-5-enyl]-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-6-bromo-2-[(2S)-2,6-dimethylhept-5-enyl]-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 59026899 |
| Molecular Formula | C14H23BrO |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (2R,6R)-6-bromo-2-[(2S)-2,6-dimethylhept-5-enyl]-3,6-dihydro-2H-pyran |
| SMILES | CC(C)=CCC[C@H](C)C[C@@H]1CC=C[C@@H](Br)O1 |
| InChI | InChI=1S/C14H23BrO/c1-11(2)6-4-7-12(3)10-13-8-5-9-14(15)16-13/h5-6,9,12-14H,4,7-8,10H2,1-3H3/t12-,13-,14-/m0/s1 |
| InChIKey | OXZLSFUSPKCKGG-IHRRRGAJSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|