C22H44O4Si — CID 59026954
(6S)-7-[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]-2,6-dimethylheptane-2,3-diol (PubChem CID 59026954) has the molecular formula C22H44O4Si and a molecular weight of 400.68 g/mol. Its IUPAC name is (6S)-7-[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]-2,6-dimethylheptane-2,3-diol.
| Compound Name | (6S)-7-[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]-2,6-dimethylheptane-2,3-diol |
|---|---|
| PubChem CID | 59026954 |
| Molecular Formula | C22H44O4Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | (6S)-7-[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]-2,6-dimethylheptane-2,3-diol |
| SMILES | C[C@@H](CCC(O)C(C)(C)O)C[C@@H]1CC=C[C@@H](CCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H44O4Si/c1-17(12-13-20(23)22(5,6)24)16-19-11-9-10-18(26-19)14-15-25-27(7,8)21(2,3)4/h9-10,17-20,23-24H,11-16H2,1-8H3/t17-,18-,19-,20?/m0/s1 |
| InChIKey | RTUVAXXCBVQOHY-TWQWKPIESA-N |
| XLogP | 5.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|