C13H18O4 — CID 59026958
(2R,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-2-prop-2-ynyl-3,6-dihydro-2H-pyran (PubChem CID 59026958) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (2R,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-2-prop-2-ynyl-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-2-prop-2-ynyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 59026958 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2R,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-2-prop-2-ynyl-3,6-dihydro-2H-pyran |
| SMILES | C#CC[C@H]1O[C@H](CC2OCCO2)C=C[C@@H]1OC |
| InChI | InChI=1S/C13H18O4/c1-3-4-12-11(14-2)6-5-10(17-12)9-13-15-7-8-16-13/h1,5-6,10-13H,4,7-9H2,2H3/t10-,11-,12+/m0/s1 |
| InChIKey | ADEBQLQBZJKUDG-SDDRHHMPSA-N |
| XLogP | 1.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|