C17H30O2 — CID 59026961
(4S,6S)-4-(1-methoxyprop-2-enoxy)-6,10-dimethylundeca-1,9-diene (PubChem CID 59026961) has the molecular formula C17H30O2 and a molecular weight of 266.43 g/mol. Its IUPAC name is (4S,6S)-4-(1-methoxyprop-2-enoxy)-6,10-dimethylundeca-1,9-diene.
| Compound Name | (4S,6S)-4-(1-methoxyprop-2-enoxy)-6,10-dimethylundeca-1,9-diene |
|---|---|
| PubChem CID | 59026961 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (4S,6S)-4-(1-methoxyprop-2-enoxy)-6,10-dimethylundeca-1,9-diene |
| SMILES | C=CC[C@@H](C[C@@H](C)CCC=C(C)C)OC(C=C)OC |
| InChI | InChI=1S/C17H30O2/c1-7-10-16(19-17(8-2)18-6)13-15(5)12-9-11-14(3)4/h7-8,11,15-17H,1-2,9-10,12-13H2,3-6H3/t15-,16-,17?/m0/s1 |
| InChIKey | SUYUBDXDITZGEA-PYNWJHIZSA-N |
| XLogP | 4.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|