C32H54O7Si — CID 59026965
[(E,1S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-methylidene-10-[(2R,6R)-6-(2-oxoethyl)-3,6-dihydro-2H-pyran-2-yl]dec-3-enyl] propanoate (PubChem CID 59026965) has the molecular formula C32H54O7Si and a molecular weight of 578.86 g/mol. Its IUPAC name is [(E,1S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-methylidene-10-[(2R,6R)-6-(2-oxoethyl)-3,6-dihydro-2H-pyran-2-yl]dec-3-enyl] propanoate.
| Compound Name | [(E,1S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-methylidene-10-[(2R,6R)-6-(2-oxoethyl)-3,6-dihydro-2H-pyran-2-yl]dec-3-enyl] propanoate |
|---|---|
| PubChem CID | 59026965 |
| Molecular Formula | C32H54O7Si |
| Molecular Weight | 578.86 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | [(E,1S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-methylidene-10-[(2R,6R)-6-(2-oxoethyl)-3,6-dihydro-2H-pyran-2-yl]dec-3-enyl] propanoate |
| SMILES | C=C(CCC[C@@H]1CC=C[C@@H](CC=O)O1)CC(/C=C/C[C@H](OC(=O)CC)[C@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H54O7Si/c1-10-30(34)37-28(29-23-35-32(6,7)38-29)19-13-18-27(39-40(8,9)31(3,4)5)22-24(2)14-11-15-25-16-12-17-26(36-25)20-21-33/h12-13,17-18,21,25-29H,2,10-11,14-16,19-20,22-23H2,1,3-9H3/b18-13+/t25-,26+,27?,28+,29-/m1/s1 |
| InChIKey | WBXWDVBJGOXYMG-VTUDWJKSSA-N |
| XLogP | 7.22 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.86 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|