C16H28O2 — CID 59026991
2-[(2R,6R)-2-[(2S)-2,6-dimethylhept-5-enyl]-3,6-dihydro-2H-pyran-6-yl]ethanol (PubChem CID 59026991) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-[(2R,6R)-2-[(2S)-2,6-dimethylhept-5-enyl]-3,6-dihydro-2H-pyran-6-yl]ethanol.
| Compound Name | 2-[(2R,6R)-2-[(2S)-2,6-dimethylhept-5-enyl]-3,6-dihydro-2H-pyran-6-yl]ethanol |
|---|---|
| PubChem CID | 59026991 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2-[(2R,6R)-2-[(2S)-2,6-dimethylhept-5-enyl]-3,6-dihydro-2H-pyran-6-yl]ethanol |
| SMILES | CC(C)=CCC[C@H](C)C[C@@H]1CC=C[C@@H](CCO)O1 |
| InChI | InChI=1S/C16H28O2/c1-13(2)6-4-7-14(3)12-16-9-5-8-15(18-16)10-11-17/h5-6,8,14-17H,4,7,9-12H2,1-3H3/t14-,15-,16-/m0/s1 |
| InChIKey | QZDDQTMYYPQJRB-JYJNAYRXSA-N |
| XLogP | 3.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|