C16H30O5Si — CID 59027009
(2R,3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(1,3-dioxolan-2-ylmethyl)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 59027009) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is (2R,3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(1,3-dioxolan-2-ylmethyl)-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(1,3-dioxolan-2-ylmethyl)-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 59027009 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (2R,3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(1,3-dioxolan-2-ylmethyl)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](CC2OCCO2)C=C[C@@H]1O |
| InChI | InChI=1S/C16H30O5Si/c1-16(2,3)22(4,5)20-11-14-13(17)7-6-12(21-14)10-15-18-8-9-19-15/h6-7,12-15,17H,8-11H2,1-5H3/t12-,13-,14+/m0/s1 |
| InChIKey | WKBVRALPVUMUHY-MELADBBJSA-N |
| XLogP | 2.46 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|