C19H35BrO2Si — CID 59027010
2-[(2R,6R)-2-[4-(bromomethyl)pent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 59027010) has the molecular formula C19H35BrO2Si and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[(2R,6R)-2-[4-(bromomethyl)pent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[(2R,6R)-2-[4-(bromomethyl)pent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 59027010 |
| Molecular Formula | C19H35BrO2Si |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-[(2R,6R)-2-[4-(bromomethyl)pent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | C=C(CBr)CCC[C@@H]1CC=C[C@@H](CCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C19H35BrO2Si/c1-16(15-20)9-7-10-17-11-8-12-18(22-17)13-14-21-23(5,6)19(2,3)4/h8,12,17-18H,1,7,9-11,13-15H2,2-6H3/t17-,18+/m1/s1 |
| InChIKey | LGZVRZGLVCSQHZ-MSOLQXFVSA-N |
| XLogP | 6.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|