C14H24O2 — CID 59027016
(2S)-2-[(E,3S)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran (PubChem CID 59027016) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (2S)-2-[(E,3S)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S)-2-[(E,3S)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 59027016 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (2S)-2-[(E,3S)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran |
| SMILES | CO[C@@H](/C=C/[C@@H]1CC(C)=CCO1)C(C)(C)C |
| InChI | InChI=1S/C14H24O2/c1-11-8-9-16-12(10-11)6-7-13(15-5)14(2,3)4/h6-8,12-13H,9-10H2,1-5H3/b7-6+/t12-,13+/m1/s1 |
| InChIKey | HDCOIRCMQSNJAP-VWWYUBIBSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|