C23H34O6 — CID 59027017
(1R,3Z,7S,9E,15S,17R)-7-[(1S)-1,2-dihydroxyethyl]-11-hydroxy-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one (PubChem CID 59027017) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is (1R,3Z,7S,9E,15S,17R)-7-[(1S)-1,2-dihydroxyethyl]-11-hydroxy-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one.
| Compound Name | (1R,3Z,7S,9E,15S,17R)-7-[(1S)-1,2-dihydroxyethyl]-11-hydroxy-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
|---|---|
| PubChem CID | 59027017 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (1R,3Z,7S,9E,15S,17R)-7-[(1S)-1,2-dihydroxyethyl]-11-hydroxy-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
| SMILES | C=C1CC(O)/C=C/C[C@@H]([C@@H](O)CO)OC(=O)/C=C\C[C@@H]2C=CC[C@@H](C[C@@H](C)C1)O2 |
| InChI | InChI=1S/C23H34O6/c1-16-12-17(2)14-20-9-4-7-19(28-20)8-5-11-23(27)29-22(21(26)15-24)10-3-6-18(25)13-16/h3-7,11,17-22,24-26H,1,8-10,12-15H2,2H3/b6-3+,11-5-/t17-,18?,19-,20-,21-,22-/m0/s1 |
| InChIKey | BFJFFYPAHNCTLX-WKOKBUCRSA-N |
| XLogP | 2.59 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|