C16H24O4 — CID 59027068
[(4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-(2-oxoethyl)-3,6-dihydro-2H-pyran-2-yl]pentyl] acetate (PubChem CID 59027068) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is [(4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-(2-oxoethyl)-3,6-dihydro-2H-pyran-2-yl]pentyl] acetate.
| Compound Name | [(4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-(2-oxoethyl)-3,6-dihydro-2H-pyran-2-yl]pentyl] acetate |
|---|---|
| PubChem CID | 59027068 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [(4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-(2-oxoethyl)-3,6-dihydro-2H-pyran-2-yl]pentyl] acetate |
| SMILES | C=C(COC(C)=O)C[C@H](C)C[C@@H]1CC=C[C@@H](CC=O)O1 |
| InChI | InChI=1S/C16H24O4/c1-12(9-13(2)11-19-14(3)18)10-16-6-4-5-15(20-16)7-8-17/h4-5,8,12,15-16H,2,6-7,9-11H2,1,3H3/t12-,15-,16-/m0/s1 |
| InChIKey | IZAWTDMBGANWGM-RCBQFDQVSA-N |
| XLogP | 2.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|