About sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine
sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine (PubChem CID 59027490) has the molecular formula C8H13N4NaO3
and a molecular weight of 236.21 g/mol. Its IUPAC name is sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine.
Molecular Properties
| Compound Name | sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine |
| PubChem CID | 59027490 |
| Molecular Formula | C8H13N4NaO3 |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine |
| SMILES | [H]/N=C1\N=C(OC)C(C)CC1(C)/N=N/O[O-].[Na+] |
| InChI | InChI=1S/C8H14N4O3.Na/c1-5-4-8(2,11-12-15-13)7(9)10-6(5)14-3;/h5,9,13H,4H2,1-3H3;/q;+1/p-1/b9-7-,12-11+; |
| InChIKey | ATEYOKUCUZCOMT-OQOJLJFXSA-M |
| XLogP | -2.53 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine?
The IUPAC name of sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine (CID 59027490) is sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine.
What is the SMILES notation for sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine?
The canonical SMILES for sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine is [H]/N=C1\N=C(OC)C(C)CC1(C)/N=N/O[O-].[Na+].
What is the InChIKey of sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine?
The InChIKey is ATEYOKUCUZCOMT-OQOJLJFXSA-M. The full InChI is InChI=1S/C8H14N4O3.Na/c1-5-4-8(2,11-12-15-13)7(9)10-6(5)14-3;/h5,9,13H,4H2,1-3H3;/q;+1/p-1/b9-7-,12-11+;.
What are the key properties of sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine?
sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine has a molecular weight of 236.21 g/mol, XLogP of -2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-methoxy-3,5-dimethyl-5-(oxidooxydiazenyl)-3,4-dihydropyridin-6-imine is sourced from PubChem (CID 59027490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).