C19H16O5S2 — CID 59027675
5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-7-(4-methoxyphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 59027675) has the molecular formula C19H16O5S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-7-(4-methoxyphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-7-(4-methoxyphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 59027675 |
| Molecular Formula | C19H16O5S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-7-(4-methoxyphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | COc1ccc(-c2sc(-c3scc4c3OCCO4)c3c2OCCO3)cc1 |
| InChI | InChI=1S/C19H16O5S2/c1-20-12-4-2-11(3-5-12)17-15-16(24-9-8-23-15)19(26-17)18-14-13(10-25-18)21-6-7-22-14/h2-5,10H,6-9H2,1H3 |
| InChIKey | PERXORUDXOYQLQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |