C40H36IrN2O4-2 — CID 59027684
(Z)-1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]phenoxy]-4-hydroxy-5-methoxypent-3-en-2-one;iridium;bis(2-phenylpyridine) (PubChem CID 59027684) has the molecular formula C40H36IrN2O4-2 and a molecular weight of 800.95 g/mol. Its IUPAC name is (Z)-1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]phenoxy]-4-hydroxy-5-methoxypent-3-en-2-one;iridium;bis(2-phenylpyridine).
| Compound Name | (Z)-1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]phenoxy]-4-hydroxy-5-methoxypent-3-en-2-one;iridium;bis(2-phenylpyridine) |
|---|---|
| PubChem CID | 59027684 |
| Molecular Formula | C40H36IrN2O4-2 |
| Molecular Weight | 800.95 g/mol |
| Exact Mass | 801.23 |
| IUPAC Name | (Z)-1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]phenoxy]-4-hydroxy-5-methoxypent-3-en-2-one;iridium;bis(2-phenylpyridine) |
| SMILES | C=C/C=C\C(=C)c1ccc(OCC(=O)/C=C(\O)COC)cc1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C18H20O4.2C11H8N.Ir/c1-4-5-6-14(2)15-7-9-18(10-8-15)22-13-17(20)11-16(19)12-21-3;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-11,19H,1-2,12-13H2,3H3;2*1-6,8-9H;/q;2*-1;/b6-5-,16-11-;;; |
| InChIKey | CJDIFDLOGKACBO-MDSBKBAASA-N |
| XLogP | 8.57 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.95 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|