C10H19OY- — CID 59027829
(2R,3S,4S,5R,6R)-2-methanidyl-3,4,5,6-tetramethyloxane;yttrium (PubChem CID 59027829) has the molecular formula C10H19OY- and a molecular weight of 244.17 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-methanidyl-3,4,5,6-tetramethyloxane;yttrium.
| Compound Name | (2R,3S,4S,5R,6R)-2-methanidyl-3,4,5,6-tetramethyloxane;yttrium |
|---|---|
| PubChem CID | 59027829 |
| Molecular Formula | C10H19OY- |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-methanidyl-3,4,5,6-tetramethyloxane;yttrium |
| SMILES | [CH2-][C@H]1O[C@H](C)[C@H](C)[C@@H](C)[C@@H]1C.[Y] |
| InChI | InChI=1S/C10H19O.Y/c1-6-7(2)9(4)11-10(5)8(6)3;/h6-10H,4H2,1-3,5H3;/q-1;/t6-,7-,8+,9+,10+;/m0./s1 |
| InChIKey | KTGUXDSVNWJFOX-GFCNNYQPSA-N |
| XLogP | 2.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|