C25H30BrFN4O4 — CID 59028401
3-[[amino-[[2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]-3-piperidin-4-ylpropanoic acid (PubChem CID 59028401) has the molecular formula C25H30BrFN4O4 and a molecular weight of 549.44 g/mol. Its IUPAC name is 3-[[amino-[[2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]-3-piperidin-4-ylpropanoic acid.
| Compound Name | 3-[[amino-[[2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]-3-piperidin-4-ylpropanoic acid |
|---|---|
| PubChem CID | 59028401 |
| Molecular Formula | C25H30BrFN4O4 |
| Molecular Weight | 549.44 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 3-[[amino-[[2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]-3-piperidin-4-ylpropanoic acid |
| SMILES | COc1ccc(Br)cc1CCc1c(F)cccc1C(=O)N/C(N)=N/C(CC(=O)O)C1CCNCC1 |
| InChI | InChI=1S/C25H30BrFN4O4/c1-35-22-8-6-17(26)13-16(22)5-7-18-19(3-2-4-20(18)27)24(34)31-25(28)30-21(14-23(32)33)15-9-11-29-12-10-15/h2-4,6,8,13,15,21,29H,5,7,9-12,14H2,1H3,(H,32,33)(H3,28,30,31,34) |
| InChIKey | JMPHXXPXMZEAPQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|