About N-isoquinolin-5-yl-2,2-dimethylpropanamide
N-isoquinolin-5-yl-2,2-dimethylpropanamide (PubChem CID 59028798) has the molecular formula C14H16N2O
and a molecular weight of 228.30 g/mol. Its IUPAC name is N-isoquinolin-5-yl-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-isoquinolin-5-yl-2,2-dimethylpropanamide |
| PubChem CID | 59028798 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-isoquinolin-5-yl-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C14H16N2O/c1-14(2,3)13(17)16-12-6-4-5-10-9-15-8-7-11(10)12/h4-9H,1-3H3,(H,16,17) |
| InChIKey | ULRAAMBNUGPUAG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-isoquinolin-5-yl-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-isoquinolin-5-yl-2,2-dimethylpropanamide?
The IUPAC name of N-isoquinolin-5-yl-2,2-dimethylpropanamide (CID 59028798) is N-isoquinolin-5-yl-2,2-dimethylpropanamide.
What is the SMILES notation for N-isoquinolin-5-yl-2,2-dimethylpropanamide?
The canonical SMILES for N-isoquinolin-5-yl-2,2-dimethylpropanamide is CC(C)(C)C(=O)Nc1cccc2cnccc12.
What is the InChIKey of N-isoquinolin-5-yl-2,2-dimethylpropanamide?
The InChIKey is ULRAAMBNUGPUAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O/c1-14(2,3)13(17)16-12-6-4-5-10-9-15-8-7-11(10)12/h4-9H,1-3H3,(H,16,17).
What are the key properties of N-isoquinolin-5-yl-2,2-dimethylpropanamide?
N-isoquinolin-5-yl-2,2-dimethylpropanamide has a molecular weight of 228.30 g/mol, XLogP of 3.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-isoquinolin-5-yl-2,2-dimethylpropanamide is sourced from PubChem (CID 59028798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).