About 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole
2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole (PubChem CID 59028982) has the molecular formula C24H26N4O4S
and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole.
Molecular Properties
| Compound Name | 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole |
| PubChem CID | 59028982 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole |
| SMILES | NS(=O)(=O)NCCCC[C@H](NCC(=O)c1ccccc1)c1nc2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C24H26N4O4S/c25-33(30,31)27-15-7-6-12-20(26-16-21(29)18-9-2-1-3-10-18)24-28-23-19-11-5-4-8-17(19)13-14-22(23)32-24/h1-5,8-11,13-14,20,26-27H,6-7,12,15-16H2,(H2,25,30,31)/t20-/m0/s1 |
| InChIKey | ZDMYTERUXMKXQY-FQEVSTJZSA-N |
| XLogP | 3.46 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole?
The IUPAC name of 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole (CID 59028982) is 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole.
What is the SMILES notation for 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole?
The canonical SMILES for 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole is NS(=O)(=O)NCCCC[C@H](NCC(=O)c1ccccc1)c1nc2c(ccc3ccccc32)o1.
What is the InChIKey of 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole?
The InChIKey is ZDMYTERUXMKXQY-FQEVSTJZSA-N. The full InChI is InChI=1S/C24H26N4O4S/c25-33(30,31)27-15-7-6-12-20(26-16-21(29)18-9-2-1-3-10-18)24-28-23-19-11-5-4-8-17(19)13-14-22(23)32-24/h1-5,8-11,13-14,20,26-27H,6-7,12,15-16H2,(H2,25,30,31)/t20-/m0/s1.
What are the key properties of 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole?
2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole has a molecular weight of 466.56 g/mol, XLogP of 3.46, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-1-(phenacylamino)-5-(sulfamoylamino)pentyl]benzo[e][1,3]benzoxazole is sourced from PubChem (CID 59028982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).