C19H15Cl2NO4 — CID 59029128
2-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoic acid (PubChem CID 59029128) has the molecular formula C19H15Cl2NO4 and a molecular weight of 392.24 g/mol. Its IUPAC name is 2-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoic acid.
| Compound Name | 2-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 59029128 |
| Molecular Formula | C19H15Cl2NO4 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoic acid |
| SMILES | Cc1c(C(C)C(=O)O)c2cc(O)ccc2n1C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H15Cl2NO4/c1-9(19(25)26)17-10(2)22(16-6-4-12(23)8-13(16)17)18(24)11-3-5-14(20)15(21)7-11/h3-9,23H,1-2H3,(H,25,26) |
| InChIKey | QSKUKSMCUNEHQL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |