About tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate
tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate (PubChem CID 59029205) has the molecular formula C25H21ClF3NO3
and a molecular weight of 475.89 g/mol. Its IUPAC name is tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate |
| PubChem CID | 59029205 |
| Molecular Formula | C25H21ClF3NO3 |
| Molecular Weight | 475.89 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(C(=O)c1c(F)cc(F)cc1F)c1cccc(-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C25H21ClF3NO3/c1-25(2,3)33-22(31)14-30(24(32)23-20(28)12-18(27)13-21(23)29)19-9-5-7-16(11-19)15-6-4-8-17(26)10-15/h4-13H,14H2,1-3H3 |
| InChIKey | WSMGJCOYQNTKIP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.89 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate?
The IUPAC name of tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate (CID 59029205) is tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate.
What is the SMILES notation for tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate?
The canonical SMILES for tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate is CC(C)(C)OC(=O)CN(C(=O)c1c(F)cc(F)cc1F)c1cccc(-c2cccc(Cl)c2)c1.
What is the InChIKey of tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate?
The InChIKey is WSMGJCOYQNTKIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21ClF3NO3/c1-25(2,3)33-22(31)14-30(24(32)23-20(28)12-18(27)13-21(23)29)19-9-5-7-16(11-19)15-6-4-8-17(26)10-15/h4-13H,14H2,1-3H3.
What are the key properties of tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate?
tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate has a molecular weight of 475.89 g/mol, XLogP of 6.41, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[3-(3-chlorophenyl)-N-(2,4,6-trifluorobenzoyl)anilino]acetate is sourced from PubChem (CID 59029205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).