About ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate
ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate (PubChem CID 59029212) has the molecular formula C28H27F2NO5
and a molecular weight of 495.52 g/mol. Its IUPAC name is ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate.
Molecular Properties
| Compound Name | ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate |
| PubChem CID | 59029212 |
| Molecular Formula | C28H27F2NO5 |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2cccc(N(CC(=O)OC(C)(C)C)C(=O)c3c(F)cccc3F)c2)c1 |
| InChI | InChI=1S/C28H27F2NO5/c1-5-35-27(34)20-11-6-9-18(15-20)19-10-7-12-21(16-19)31(17-24(32)36-28(2,3)4)26(33)25-22(29)13-8-14-23(25)30/h6-16H,5,17H2,1-4H3 |
| InChIKey | FRQJPWWKXHTBLU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate?
The IUPAC name of ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate (CID 59029212) is ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate.
What is the SMILES notation for ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate?
The canonical SMILES for ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate is CCOC(=O)c1cccc(-c2cccc(N(CC(=O)OC(C)(C)C)C(=O)c3c(F)cccc3F)c2)c1.
What is the InChIKey of ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate?
The InChIKey is FRQJPWWKXHTBLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27F2NO5/c1-5-35-27(34)20-11-6-9-18(15-20)19-10-7-12-21(16-19)31(17-24(32)36-28(2,3)4)26(33)25-22(29)13-8-14-23(25)30/h6-16H,5,17H2,1-4H3.
What are the key properties of ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate?
ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate has a molecular weight of 495.52 g/mol, XLogP of 5.80, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate is sourced from PubChem (CID 59029212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).