About methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate
methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate (PubChem CID 59029311) has the molecular formula C27H25F2NO5
and a molecular weight of 481.50 g/mol. Its IUPAC name is methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate |
| PubChem CID | 59029311 |
| Molecular Formula | C27H25F2NO5 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cccc(N(CC(=O)OC(C)(C)C)C(=O)c3c(F)cccc3F)c2)cc1 |
| InChI | InChI=1S/C27H25F2NO5/c1-27(2,3)35-23(31)16-30(25(32)24-21(28)9-6-10-22(24)29)20-8-5-7-19(15-20)17-11-13-18(14-12-17)26(33)34-4/h5-15H,16H2,1-4H3 |
| InChIKey | ZAEWELBUZDLFOX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate?
The IUPAC name of methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate (CID 59029311) is methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate.
What is the SMILES notation for methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate?
The canonical SMILES for methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate is COC(=O)c1ccc(-c2cccc(N(CC(=O)OC(C)(C)C)C(=O)c3c(F)cccc3F)c2)cc1.
What is the InChIKey of methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate?
The InChIKey is ZAEWELBUZDLFOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25F2NO5/c1-27(2,3)35-23(31)16-30(25(32)24-21(28)9-6-10-22(24)29)20-8-5-7-19(15-20)17-11-13-18(14-12-17)26(33)34-4/h5-15H,16H2,1-4H3.
What are the key properties of methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate?
methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate has a molecular weight of 481.50 g/mol, XLogP of 5.41, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3-[(2,6-difluorobenzoyl)-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]benzoate is sourced from PubChem (CID 59029311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).