C24H50O5Si4 — CID 59029802
4-[3-[(6-hydroxyhexyl-methyl-trimethylsilyloxysilyl)oxy-methyl-trimethylsilylsilyl]propyl]-2-methoxyphenol (PubChem CID 59029802) has the molecular formula C24H50O5Si4 and a molecular weight of 531.00 g/mol. Its IUPAC name is 4-[3-[(6-hydroxyhexyl-methyl-trimethylsilyloxysilyl)oxy-methyl-trimethylsilylsilyl]propyl]-2-methoxyphenol.
| Compound Name | 4-[3-[(6-hydroxyhexyl-methyl-trimethylsilyloxysilyl)oxy-methyl-trimethylsilylsilyl]propyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 59029802 |
| Molecular Formula | C24H50O5Si4 |
| Molecular Weight | 531.00 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 4-[3-[(6-hydroxyhexyl-methyl-trimethylsilyloxysilyl)oxy-methyl-trimethylsilylsilyl]propyl]-2-methoxyphenol |
| SMILES | COc1cc(CCC[Si](C)(O[Si](C)(CCCCCCO)O[Si](C)(C)C)[Si](C)(C)C)ccc1O |
| InChI | InChI=1S/C24H50O5Si4/c1-27-24-21-22(16-17-23(24)26)15-14-20-33(9,31(5,6)7)29-32(8,28-30(2,3)4)19-13-11-10-12-18-25/h16-17,21,25-26H,10-15,18-20H2,1-9H3 |
| InChIKey | LLVJINBEJQXAQM-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.00 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|