C8H7F9O — CID 59030010
6-ethenoxy-1,1,1,2,2,3,3,4,4-nonafluorohexane (PubChem CID 59030010) has the molecular formula C8H7F9O and a molecular weight of 290.12 g/mol. Its IUPAC name is 6-ethenoxy-1,1,1,2,2,3,3,4,4-nonafluorohexane.
| Compound Name | 6-ethenoxy-1,1,1,2,2,3,3,4,4-nonafluorohexane |
|---|---|
| PubChem CID | 59030010 |
| Molecular Formula | C8H7F9O |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 6-ethenoxy-1,1,1,2,2,3,3,4,4-nonafluorohexane |
| SMILES | C=COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F9O/c1-2-18-4-3-5(9,10)6(11,12)7(13,14)8(15,16)17/h2H,1,3-4H2 |
| InChIKey | LAFIDLOOPJPAPN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|