C57H52N6O12 — CID 59030029
(4-methylphenyl) 4-[[4,6-bis[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyanilino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 59030029) has the molecular formula C57H52N6O12 and a molecular weight of 1013.07 g/mol. Its IUPAC name is (4-methylphenyl) 4-[[4,6-bis[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyanilino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | (4-methylphenyl) 4-[[4,6-bis[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyanilino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 59030029 |
| Molecular Formula | C57H52N6O12 |
| Molecular Weight | 1013.07 g/mol |
| Exact Mass | 1012.36 |
| IUPAC Name | (4-methylphenyl) 4-[[4,6-bis[4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyanilino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(Nc3nc(Nc4ccc(OC(=O)c5ccc(OCCCCOC(=O)C=C)cc5)cc4)nc(Nc4ccc(C(=O)Oc5ccc(C)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C57H52N6O12/c1-4-50(64)71-36-8-6-34-69-45-26-14-40(15-27-45)53(67)74-48-30-20-43(21-31-48)59-56-61-55(58-42-18-12-39(13-19-42)52(66)73-47-24-10-38(3)11-25-47)62-57(63-56)60-44-22-32-49(33-23-44)75-54(68)41-16-28-46(29-17-41)70-35-7-9-37-72-51(65)5-2/h4-5,10-33H,1-2,6-9,34-37H2,3H3,(H3,58,59,60,61,62,63) |
| InChIKey | ATDCYXAGFQQJHV-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 224.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.07 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|