C20H33NO6 — CID 59030090
diethyl 3,4-bis(2,2-dimethylpropoxy)-1H-pyrrole-2,5-dicarboxylate (PubChem CID 59030090) has the molecular formula C20H33NO6 and a molecular weight of 383.49 g/mol. Its IUPAC name is diethyl 3,4-bis(2,2-dimethylpropoxy)-1H-pyrrole-2,5-dicarboxylate.
| Compound Name | diethyl 3,4-bis(2,2-dimethylpropoxy)-1H-pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 59030090 |
| Molecular Formula | C20H33NO6 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | diethyl 3,4-bis(2,2-dimethylpropoxy)-1H-pyrrole-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(C(=O)OCC)c(OCC(C)(C)C)c1OCC(C)(C)C |
| InChI | InChI=1S/C20H33NO6/c1-9-24-17(22)13-15(26-11-19(3,4)5)16(27-12-20(6,7)8)14(21-13)18(23)25-10-2/h21H,9-12H2,1-8H3 |
| InChIKey | PSWWXRGCAAXCSD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |