About [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate
[3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate (PubChem CID 59030300) has the molecular formula C22H29NO4
and a molecular weight of 371.48 g/mol. Its IUPAC name is [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate.
Molecular Properties
| Compound Name | [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate |
| PubChem CID | 59030300 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate |
| SMILES | CCc1cc(C)cc(C)c1C1=C(OC(C)=O)C2(CCC(OC)CC2)NC1=O |
| InChI | InChI=1S/C22H29NO4/c1-6-16-12-13(2)11-14(3)18(16)19-20(27-15(4)24)22(23-21(19)25)9-7-17(26-5)8-10-22/h11-12,17H,6-10H2,1-5H3,(H,23,25) |
| InChIKey | ZXESLEFXBUNFSD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate?
The IUPAC name of [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate (CID 59030300) is [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate.
What is the SMILES notation for [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate?
The canonical SMILES for [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate is CCc1cc(C)cc(C)c1C1=C(OC(C)=O)C2(CCC(OC)CC2)NC1=O.
What is the InChIKey of [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate?
The InChIKey is ZXESLEFXBUNFSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO4/c1-6-16-12-13(2)11-14(3)18(16)19-20(27-15(4)24)22(23-21(19)25)9-7-17(26-5)8-10-22/h11-12,17H,6-10H2,1-5H3,(H,23,25).
What are the key properties of [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate?
[3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate has a molecular weight of 371.48 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] acetate is sourced from PubChem (CID 59030300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).