About 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide
6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide (PubChem CID 59031027) has the molecular formula C6H10O3S
and a molecular weight of 162.21 g/mol. Its IUPAC name is 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide.
Molecular Properties
| Compound Name | 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide |
| PubChem CID | 59031027 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide |
| SMILES | O=S1OCC2(CCC2)CO1 |
| InChI | InChI=1S/C6H10O3S/c7-10-8-4-6(5-9-10)2-1-3-6/h1-5H2 |
| InChIKey | GXZXLFVEGVDXMG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide?
The IUPAC name of 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide (CID 59031027) is 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide.
What is the SMILES notation for 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide?
The canonical SMILES for 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide is O=S1OCC2(CCC2)CO1.
What is the InChIKey of 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide?
The InChIKey is GXZXLFVEGVDXMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3S/c7-10-8-4-6(5-9-10)2-1-3-6/h1-5H2.
What are the key properties of 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide?
6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide has a molecular weight of 162.21 g/mol, XLogP of 0.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dioxa-7λ4-thiaspiro[3.5]nonane 7-oxide is sourced from PubChem (CID 59031027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).