About 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole
6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 59031102) has the molecular formula C22H21F3N2S
and a molecular weight of 402.49 g/mol. Its IUPAC name is 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole |
| PubChem CID | 59031102 |
| Molecular Formula | C22H21F3N2S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | FC(F)(F)c1ccccc1-c1csc2nc(C34CC5CC(CC(C5)C3)C4)cn12 |
| InChI | InChI=1S/C22H21F3N2S/c23-22(24,25)17-4-2-1-3-16(17)18-12-28-20-26-19(11-27(18)20)21-8-13-5-14(9-21)7-15(6-13)10-21/h1-4,11-15H,5-10H2 |
| InChIKey | YUWGGJQEVZSERP-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole?
The IUPAC name of 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole (CID 59031102) is 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole is FC(F)(F)c1ccccc1-c1csc2nc(C34CC5CC(CC(C5)C3)C4)cn12.
What is the InChIKey of 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole?
The InChIKey is YUWGGJQEVZSERP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F3N2S/c23-22(24,25)17-4-2-1-3-16(17)18-12-28-20-26-19(11-27(18)20)21-8-13-5-14(9-21)7-15(6-13)10-21/h1-4,11-15H,5-10H2.
What are the key properties of 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole?
6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole has a molecular weight of 402.49 g/mol, XLogP of 6.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-adamantyl)-3-[2-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 59031102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).