C22H22F3NO2 — CID 59031174
(Z)-3-[4-[4-(cyclopentylamino)phenyl]-2,5-difluoro-3,6-dimethylphenyl]-2-fluoroprop-2-enoic acid (PubChem CID 59031174) has the molecular formula C22H22F3NO2 and a molecular weight of 389.42 g/mol. Its IUPAC name is (Z)-3-[4-[4-(cyclopentylamino)phenyl]-2,5-difluoro-3,6-dimethylphenyl]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[4-[4-(cyclopentylamino)phenyl]-2,5-difluoro-3,6-dimethylphenyl]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 59031174 |
| Molecular Formula | C22H22F3NO2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (Z)-3-[4-[4-(cyclopentylamino)phenyl]-2,5-difluoro-3,6-dimethylphenyl]-2-fluoroprop-2-enoic acid |
| SMILES | Cc1c(F)c(-c2ccc(NC3CCCC3)cc2)c(C)c(F)c1/C=C(\F)C(=O)O |
| InChI | InChI=1S/C22H22F3NO2/c1-12-17(11-18(23)22(27)28)20(24)13(2)19(21(12)25)14-7-9-16(10-8-14)26-15-5-3-4-6-15/h7-11,15,26H,3-6H2,1-2H3,(H,27,28)/b18-11- |
| InChIKey | RABIMQSEPSHSIZ-WQRHYEAKSA-N |
| XLogP | 6.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|