C22H23F2N3O — CID 59031378
(E)-N-cyano-3-[2,5-difluoro-3,6-dimethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]-2-methylprop-2-enamide (PubChem CID 59031378) has the molecular formula C22H23F2N3O and a molecular weight of 383.44 g/mol. Its IUPAC name is (E)-N-cyano-3-[2,5-difluoro-3,6-dimethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-cyano-3-[2,5-difluoro-3,6-dimethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 59031378 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (E)-N-cyano-3-[2,5-difluoro-3,6-dimethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1c(C)c(F)c(-c2ccc(NC(C)C)cc2)c(C)c1F)C(=O)NC#N |
| InChI | InChI=1S/C22H23F2N3O/c1-12(2)27-17-8-6-16(7-9-17)19-15(5)20(23)18(14(4)21(19)24)10-13(3)22(28)26-11-25/h6-10,12,27H,1-5H3,(H,26,28)/b13-10+ |
| InChIKey | BWRXYUWJCBAXQE-JLHYYAGUSA-N |
| XLogP | 5.07 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|