C23H24N2O — CID 59031388
(E)-N-cyclopropyl-3-[4-(1H-indol-4-yl)-2,5-dimethylphenyl]-2-methylprop-2-enamide (PubChem CID 59031388) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is (E)-N-cyclopropyl-3-[4-(1H-indol-4-yl)-2,5-dimethylphenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-3-[4-(1H-indol-4-yl)-2,5-dimethylphenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 59031388 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (E)-N-cyclopropyl-3-[4-(1H-indol-4-yl)-2,5-dimethylphenyl]-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1cc(C)c(-c2cccc3[nH]ccc23)cc1C)C(=O)NC1CC1 |
| InChI | InChI=1S/C23H24N2O/c1-14-13-21(19-5-4-6-22-20(19)9-10-24-22)15(2)11-17(14)12-16(3)23(26)25-18-7-8-18/h4-6,9-13,18,24H,7-8H2,1-3H3,(H,25,26)/b16-12+ |
| InChIKey | YRFJMNAUBXHQBO-FOWTUZBSSA-N |
| XLogP | 5.13 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|