C23H28FNO2 — CID 59031466
(E)-3-[4-[3-fluoro-4-(propan-2-ylamino)phenyl]-2,3,5,6-tetramethylphenyl]-2-methylprop-2-enoic acid (PubChem CID 59031466) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is (E)-3-[4-[3-fluoro-4-(propan-2-ylamino)phenyl]-2,3,5,6-tetramethylphenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-fluoro-4-(propan-2-ylamino)phenyl]-2,3,5,6-tetramethylphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 59031466 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (E)-3-[4-[3-fluoro-4-(propan-2-ylamino)phenyl]-2,3,5,6-tetramethylphenyl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1c(C)c(C)c(-c2ccc(NC(C)C)c(F)c2)c(C)c1C)C(=O)O |
| InChI | InChI=1S/C23H28FNO2/c1-12(2)25-21-9-8-18(11-20(21)24)22-16(6)14(4)19(15(5)17(22)7)10-13(3)23(26)27/h8-12,25H,1-7H3,(H,26,27)/b13-10+ |
| InChIKey | WFLMSTDMFVMIRV-JLHYYAGUSA-N |
| XLogP | 6.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|