C25H28F2N2O3 — CID 59031504
2-[[(E)-3-[2,5-difluoro-3,6-dimethyl-4-[4-(3-methylbut-2-enylamino)phenyl]phenyl]-2-methylprop-2-enoyl]amino]acetic acid (PubChem CID 59031504) has the molecular formula C25H28F2N2O3 and a molecular weight of 442.51 g/mol. Its IUPAC name is 2-[[(E)-3-[2,5-difluoro-3,6-dimethyl-4-[4-(3-methylbut-2-enylamino)phenyl]phenyl]-2-methylprop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[(E)-3-[2,5-difluoro-3,6-dimethyl-4-[4-(3-methylbut-2-enylamino)phenyl]phenyl]-2-methylprop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 59031504 |
| Molecular Formula | C25H28F2N2O3 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-[[(E)-3-[2,5-difluoro-3,6-dimethyl-4-[4-(3-methylbut-2-enylamino)phenyl]phenyl]-2-methylprop-2-enoyl]amino]acetic acid |
| SMILES | CC(C)=CCNc1ccc(-c2c(C)c(F)c(/C=C(\C)C(=O)NCC(=O)O)c(C)c2F)cc1 |
| InChI | InChI=1S/C25H28F2N2O3/c1-14(2)10-11-28-19-8-6-18(7-9-19)22-17(5)23(26)20(16(4)24(22)27)12-15(3)25(32)29-13-21(30)31/h6-10,12,28H,11,13H2,1-5H3,(H,29,32)(H,30,31)/b15-12+ |
| InChIKey | IZDKFVQJFQWSPQ-NTCAYCPXSA-N |
| XLogP | 5.23 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|